About 4-chloro-3-[2-(2,3-diphenylquinoxaline-6-carbonyl)oxybutanoylamino]benzoic acid
4-chloro-3-[2-(2,3-diphenylquinoxaline-6-carbonyl)oxybutanoylamino]benzoic acid (PubChem CID 23803247) has the molecular formula C32H24ClN3O5
and a molecular weight of 566.01 g/mol. Its IUPAC name is 4-chloro-3-[2-(2,3-diphenylquinoxaline-6-carbonyl)oxybutanoylamino]benzoic acid.
Molecular Properties
| Compound Name | 4-chloro-3-[2-(2,3-diphenylquinoxaline-6-carbonyl)oxybutanoylamino]benzoic acid |
| PubChem CID | 23803247 |
| Molecular Formula | C32H24ClN3O5 |
| Molecular Weight | 566.01 g/mol |
| Exact Mass | 565.14 |
| IUPAC Name | 4-chloro-3-[2-(2,3-diphenylquinoxaline-6-carbonyl)oxybutanoylamino]benzoic acid |
| SMILES | CCC(OC(=O)c1ccc2nc(-c3ccccc3)c(-c3ccccc3)nc2c1)C(=O)Nc1cc(C(=O)O)ccc1Cl |
| InChI | InChI=1S/C32H24ClN3O5/c1-2-27(30(37)36-25-17-21(31(38)39)13-15-23(25)33)41-32(40)22-14-16-24-26(18-22)35-29(20-11-7-4-8-12-20)28(34-24)19-9-5-3-6-10-19/h3-18,27H,2H2,1H3,(H,36,37)(H,38,39) |
| InChIKey | VJACZDMVIMZSED-UHFFFAOYSA-N |
| XLogP | 6.89 |
| TPSA | 118.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 566.01 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 4-chloro-3-[2-(2,3-diphenylquinoxaline-6-carbonyl)oxybutanoylamino]benzoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-3-[2-(2,3-diphenylquinoxaline-6-carbonyl)oxybutanoylamino]benzoic acid?
The IUPAC name of 4-chloro-3-[2-(2,3-diphenylquinoxaline-6-carbonyl)oxybutanoylamino]benzoic acid (CID 23803247) is 4-chloro-3-[2-(2,3-diphenylquinoxaline-6-carbonyl)oxybutanoylamino]benzoic acid.
What is the SMILES notation for 4-chloro-3-[2-(2,3-diphenylquinoxaline-6-carbonyl)oxybutanoylamino]benzoic acid?
The canonical SMILES for 4-chloro-3-[2-(2,3-diphenylquinoxaline-6-carbonyl)oxybutanoylamino]benzoic acid is CCC(OC(=O)c1ccc2nc(-c3ccccc3)c(-c3ccccc3)nc2c1)C(=O)Nc1cc(C(=O)O)ccc1Cl.
What is the InChIKey of 4-chloro-3-[2-(2,3-diphenylquinoxaline-6-carbonyl)oxybutanoylamino]benzoic acid?
The InChIKey is VJACZDMVIMZSED-UHFFFAOYSA-N. The full InChI is InChI=1S/C32H24ClN3O5/c1-2-27(30(37)36-25-17-21(31(38)39)13-15-23(25)33)41-32(40)22-14-16-24-26(18-22)35-29(20-11-7-4-8-12-20)28(34-24)19-9-5-3-6-10-19/h3-18,27H,2H2,1H3,(H,36,37)(H,38,39).
What are the key properties of 4-chloro-3-[2-(2,3-diphenylquinoxaline-6-carbonyl)oxybutanoylamino]benzoic acid?
4-chloro-3-[2-(2,3-diphenylquinoxaline-6-carbonyl)oxybutanoylamino]benzoic acid has a molecular weight of 566.01 g/mol, XLogP of 6.89, 8 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-3-[2-(2,3-diphenylquinoxaline-6-carbonyl)oxybutanoylamino]benzoic acid is sourced from PubChem (CID 23803247), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).