C26H29N3O4 — CID 23803695
4-[3-[benzyl-(2,2,3,3-tetramethylcyclopropanecarbonyl)amino]-2,5-dioxopyrrolidin-1-yl]benzamide (PubChem CID 23803695) has the molecular formula C26H29N3O4 and a molecular weight of 447.54 g/mol. Its IUPAC name is 4-[3-[benzyl-(2,2,3,3-tetramethylcyclopropanecarbonyl)amino]-2,5-dioxopyrrolidin-1-yl]benzamide.
| Compound Name | 4-[3-[benzyl-(2,2,3,3-tetramethylcyclopropanecarbonyl)amino]-2,5-dioxopyrrolidin-1-yl]benzamide |
|---|---|
| PubChem CID | 23803695 |
| Molecular Formula | C26H29N3O4 |
| Molecular Weight | 447.54 g/mol |
| Exact Mass | 447.22 |
| IUPAC Name | 4-[3-[benzyl-(2,2,3,3-tetramethylcyclopropanecarbonyl)amino]-2,5-dioxopyrrolidin-1-yl]benzamide |
| SMILES | CC1(C)C(C(=O)N(Cc2ccccc2)C2CC(=O)N(c3ccc(C(N)=O)cc3)C2=O)C1(C)C |
| InChI | InChI=1S/C26H29N3O4/c1-25(2)21(26(25,3)4)24(33)28(15-16-8-6-5-7-9-16)19-14-20(30)29(23(19)32)18-12-10-17(11-13-18)22(27)31/h5-13,19,21H,14-15H2,1-4H3,(H2,27,31) |
| InChIKey | KBDQAKRMXVVQBW-UHFFFAOYSA-N |
| XLogP | 3.13 |
| TPSA | 100.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.54 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|