C27H22N4O4S — CID 23803820
6-benzyl-2-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile (PubChem CID 23803820) has the molecular formula C27H22N4O4S and a molecular weight of 498.56 g/mol. Its IUPAC name is 6-benzyl-2-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile.
| Compound Name | 6-benzyl-2-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile |
|---|---|
| PubChem CID | 23803820 |
| Molecular Formula | C27H22N4O4S |
| Molecular Weight | 498.56 g/mol |
| Exact Mass | 498.14 |
| IUPAC Name | 6-benzyl-2-[[5-(2-methoxy-4-nitrophenyl)furan-2-yl]methylideneamino]-5,7-dihydro-4H-thieno[2,3-c]pyridine-3-carbonitrile |
| SMILES | COc1cc([N+](=O)[O-])ccc1-c1ccc(C=Nc2sc3c(c2C#N)CCN(Cc2ccccc2)C3)o1 |
| InChI | InChI=1S/C27H22N4O4S/c1-34-25-13-19(31(32)33)7-9-22(25)24-10-8-20(35-24)15-29-27-23(14-28)21-11-12-30(17-26(21)36-27)16-18-5-3-2-4-6-18/h2-10,13,15H,11-12,16-17H2,1H3 |
| InChIKey | ZTAKSDGOHPRVTP-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 104.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.56 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|