C30H28N4O5 — CID 23804027
7-(4-methoxyphenyl)-2-methyl-N-(6-methyl-2-pyridinyl)-4-(4-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide (PubChem CID 23804027) has the molecular formula C30H28N4O5 and a molecular weight of 524.58 g/mol. Its IUPAC name is 7-(4-methoxyphenyl)-2-methyl-N-(6-methyl-2-pyridinyl)-4-(4-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide.
| Compound Name | 7-(4-methoxyphenyl)-2-methyl-N-(6-methyl-2-pyridinyl)-4-(4-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
|---|---|
| PubChem CID | 23804027 |
| Molecular Formula | C30H28N4O5 |
| Molecular Weight | 524.58 g/mol |
| Exact Mass | 524.21 |
| IUPAC Name | 7-(4-methoxyphenyl)-2-methyl-N-(6-methyl-2-pyridinyl)-4-(4-nitrophenyl)-5-oxo-4,6,7,8-tetrahydro-1H-quinoline-3-carboxamide |
| SMILES | COc1ccc(C2CC(=O)C3=C(C2)NC(C)=C(C(=O)Nc2cccc(C)n2)C3c2ccc([N+](=O)[O-])cc2)cc1 |
| InChI | InChI=1S/C30H28N4O5/c1-17-5-4-6-26(31-17)33-30(36)27-18(2)32-24-15-21(19-9-13-23(39-3)14-10-19)16-25(35)29(24)28(27)20-7-11-22(12-8-20)34(37)38/h4-14,21,28,32H,15-16H2,1-3H3,(H,31,33,36) |
| InChIKey | QFUUCFNJSPJBAC-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 123.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.58 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|