C26H30BIO5 — CID 23804808
4-[(E)-2-ethyl-4-[2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinin-6-yl]but-1-enyl]-2-iodo-6-methoxyphenol (PubChem CID 23804808) has the molecular formula C26H30BIO5 and a molecular weight of 560.24 g/mol. Its IUPAC name is 4-[(E)-2-ethyl-4-[2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinin-6-yl]but-1-enyl]-2-iodo-6-methoxyphenol.
| Compound Name | 4-[(E)-2-ethyl-4-[2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinin-6-yl]but-1-enyl]-2-iodo-6-methoxyphenol |
|---|---|
| PubChem CID | 23804808 |
| Molecular Formula | C26H30BIO5 |
| Molecular Weight | 560.24 g/mol |
| Exact Mass | 560.12 |
| IUPAC Name | 4-[(E)-2-ethyl-4-[2-hydroxy-5-(3-phenoxyprop-1-en-2-yl)-3,6-dihydrooxaborinin-6-yl]but-1-enyl]-2-iodo-6-methoxyphenol |
| SMILES | C=C(COc1ccccc1)C1=CCB(O)OC1CC/C(=C/c1cc(I)c(O)c(OC)c1)CC |
| InChI | InChI=1S/C26H30BIO5/c1-4-19(14-20-15-23(28)26(29)25(16-20)31-3)10-11-24-22(12-13-27(30)33-24)18(2)17-32-21-8-6-5-7-9-21/h5-9,12,14-16,24,29-30H,2,4,10-11,13,17H2,1,3H3/b19-14+ |
| InChIKey | BJVUXDAGVJBPMV-XMHGGMMESA-N |
| XLogP | 6.02 |
| TPSA | 68.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.24 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|