C23H25BO5S — CID 23804854
2-[(Z)-4-[(4R,7aS)-6-hydroxy-3-methyl-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]phenol (PubChem CID 23804854) has the molecular formula C23H25BO5S and a molecular weight of 424.33 g/mol. Its IUPAC name is 2-[(Z)-4-[(4R,7aS)-6-hydroxy-3-methyl-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]phenol.
| Compound Name | 2-[(Z)-4-[(4R,7aS)-6-hydroxy-3-methyl-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 23804854 |
| Molecular Formula | C23H25BO5S |
| Molecular Weight | 424.33 g/mol |
| Exact Mass | 424.15 |
| IUPAC Name | 2-[(Z)-4-[(4R,7aS)-6-hydroxy-3-methyl-1,1-dioxo-2,4,7,7a-tetrahydrothieno[2,3-d]oxaborinin-4-yl]-2-phenylbut-1-enyl]phenol |
| SMILES | CC1=C2[C@@H](CC/C(=C/c3ccccc3O)c3ccccc3)OB(O)C[C@@H]2S(=O)(=O)C1 |
| InChI | InChI=1S/C23H25BO5S/c1-16-15-30(27,28)22-14-24(26)29-21(23(16)22)12-11-18(17-7-3-2-4-8-17)13-19-9-5-6-10-20(19)25/h2-10,13,21-22,25-26H,11-12,14-15H2,1H3/b18-13-/t21-,22+/m1/s1 |
| InChIKey | NRUDWDXXIPQWBJ-QBZDTREQSA-N |
| XLogP | 3.71 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.33 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|