C21H28O4S — CID 23804918
2-[(E)-4-[(4R,6aR)-1,1-dioxo-3-propan-2-yl-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-ethylbut-1-enyl]phenol (PubChem CID 23804918) has the molecular formula C21H28O4S and a molecular weight of 376.52 g/mol. Its IUPAC name is 2-[(E)-4-[(4R,6aR)-1,1-dioxo-3-propan-2-yl-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-ethylbut-1-enyl]phenol.
| Compound Name | 2-[(E)-4-[(4R,6aR)-1,1-dioxo-3-propan-2-yl-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-ethylbut-1-enyl]phenol |
|---|---|
| PubChem CID | 23804918 |
| Molecular Formula | C21H28O4S |
| Molecular Weight | 376.52 g/mol |
| Exact Mass | 376.17 |
| IUPAC Name | 2-[(E)-4-[(4R,6aR)-1,1-dioxo-3-propan-2-yl-2,4,6,6a-tetrahydrothieno[2,3-c]furan-4-yl]-2-ethylbut-1-enyl]phenol |
| SMILES | CC/C(=C\c1ccccc1O)CC[C@H]1OC[C@H]2C1=C(C(C)C)CS2(=O)=O |
| InChI | InChI=1S/C21H28O4S/c1-4-15(11-16-7-5-6-8-18(16)22)9-10-19-21-17(14(2)3)13-26(23,24)20(21)12-25-19/h5-8,11,14,19-20,22H,4,9-10,12-13H2,1-3H3/b15-11+/t19-,20+/m1/s1 |
| InChIKey | ZBLFGNJIPQKAIL-NPVFBEAJSA-N |
| XLogP | 4.11 |
| TPSA | 63.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.52 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|