C21H25NO7 — CID 23806040
methyl (3aS,5S,5aR,7S,8aS,8bR)-5a-hydroxy-7-(3-hydroxyphenyl)-1,3-dioxo-5-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-2-carboxylate (PubChem CID 23806040) has the molecular formula C21H25NO7 and a molecular weight of 403.43 g/mol. Its IUPAC name is methyl (3aS,5S,5aR,7S,8aS,8bR)-5a-hydroxy-7-(3-hydroxyphenyl)-1,3-dioxo-5-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-2-carboxylate.
| Compound Name | methyl (3aS,5S,5aR,7S,8aS,8bR)-5a-hydroxy-7-(3-hydroxyphenyl)-1,3-dioxo-5-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-2-carboxylate |
|---|---|
| PubChem CID | 23806040 |
| Molecular Formula | C21H25NO7 |
| Molecular Weight | 403.43 g/mol |
| Exact Mass | 403.16 |
| IUPAC Name | methyl (3aS,5S,5aR,7S,8aS,8bR)-5a-hydroxy-7-(3-hydroxyphenyl)-1,3-dioxo-5-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-2-carboxylate |
| SMILES | CCC[C@H]1C[C@@H]2C(=O)N(C(=O)OC)C(=O)[C@@H]2[C@@H]2C[C@@H](c3cccc(O)c3)O[C@]12O |
| InChI | InChI=1S/C21H25NO7/c1-3-5-12-9-14-17(19(25)22(18(14)24)20(26)28-2)15-10-16(29-21(12,15)27)11-6-4-7-13(23)8-11/h4,6-8,12,14-17,23,27H,3,5,9-10H2,1-2H3/t12-,14-,15-,16-,17-,21+/m0/s1 |
| InChIKey | OCJNELXHAZVSNU-YRHOUTAHSA-N |
| XLogP | 2.35 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.43 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|