C27H29NO5 — CID 23806201
[(1R,3E)-1-[2-(2-hydroxyethoxy)phenyl]-5-(methoxymethyl)-4-quinolin-3-ylhexa-3,5-dienyl] acetate (PubChem CID 23806201) has the molecular formula C27H29NO5 and a molecular weight of 447.53 g/mol. Its IUPAC name is [(1R,3E)-1-[2-(2-hydroxyethoxy)phenyl]-5-(methoxymethyl)-4-quinolin-3-ylhexa-3,5-dienyl] acetate.
| Compound Name | [(1R,3E)-1-[2-(2-hydroxyethoxy)phenyl]-5-(methoxymethyl)-4-quinolin-3-ylhexa-3,5-dienyl] acetate |
|---|---|
| PubChem CID | 23806201 |
| Molecular Formula | C27H29NO5 |
| Molecular Weight | 447.53 g/mol |
| Exact Mass | 447.20 |
| IUPAC Name | [(1R,3E)-1-[2-(2-hydroxyethoxy)phenyl]-5-(methoxymethyl)-4-quinolin-3-ylhexa-3,5-dienyl] acetate |
| SMILES | C=C(COC)/C(=C/C[C@@H](OC(C)=O)c1ccccc1OCCO)c1cnc2ccccc2c1 |
| InChI | InChI=1S/C27H29NO5/c1-19(18-31-3)23(22-16-21-8-4-6-10-25(21)28-17-22)12-13-27(33-20(2)30)24-9-5-7-11-26(24)32-15-14-29/h4-12,16-17,27,29H,1,13-15,18H2,2-3H3/b23-12-/t27-/m1/s1 |
| InChIKey | VTXFGVDKBIUEEP-TWBUYNNTSA-N |
| XLogP | 4.89 |
| TPSA | 77.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.53 |
| LogP ≤ 5 | 4.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|