C19H32N2O3 — CID 23807469
8-oxo-8-[(2E)-2-[2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]hydrazinyl]octanoic acid (PubChem CID 23807469) has the molecular formula C19H32N2O3 and a molecular weight of 336.48 g/mol. Its IUPAC name is 8-oxo-8-[(2E)-2-[2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]hydrazinyl]octanoic acid.
| Compound Name | 8-oxo-8-[(2E)-2-[2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]hydrazinyl]octanoic acid |
|---|---|
| PubChem CID | 23807469 |
| Molecular Formula | C19H32N2O3 |
| Molecular Weight | 336.48 g/mol |
| Exact Mass | 336.24 |
| IUPAC Name | 8-oxo-8-[(2E)-2-[2-(2,6,6-trimethylcyclohexen-1-yl)ethylidene]hydrazinyl]octanoic acid |
| SMILES | CC1=C(C/C=N/NC(=O)CCCCCCC(=O)O)C(C)(C)CCC1 |
| InChI | InChI=1S/C19H32N2O3/c1-15-9-8-13-19(2,3)16(15)12-14-20-21-17(22)10-6-4-5-7-11-18(23)24/h14H,4-13H2,1-3H3,(H,21,22)(H,23,24)/b20-14+ |
| InChIKey | ITHYHYCGASMFPI-XSFVSMFZSA-N |
| XLogP | 4.43 |
| TPSA | 78.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.48 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|