About methyl 8-[(2E)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-8-oxooctanoate
methyl 8-[(2E)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-8-oxooctanoate (PubChem CID 23807492) has the molecular formula C18H25N3O7
and a molecular weight of 395.41 g/mol. Its IUPAC name is methyl 8-[(2E)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-8-oxooctanoate.
Molecular Properties
| Compound Name | methyl 8-[(2E)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-8-oxooctanoate |
| PubChem CID | 23807492 |
| Molecular Formula | C18H25N3O7 |
| Molecular Weight | 395.41 g/mol |
| Exact Mass | 395.17 |
| IUPAC Name | methyl 8-[(2E)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-8-oxooctanoate |
| SMILES | COC(=O)CCCCCCC(=O)N/N=C/c1cc(OC)c(OC)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C18H25N3O7/c1-26-15-10-13(14(21(24)25)11-16(15)27-2)12-19-20-17(22)8-6-4-5-7-9-18(23)28-3/h10-12H,4-9H2,1-3H3,(H,20,22)/b19-12+ |
| InChIKey | WSLQLRCUNJXGFU-XDHOZWIPSA-N |
| XLogP | 2.58 |
| TPSA | 129.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.41 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze methyl 8-[(2E)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-8-oxooctanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl 8-[(2E)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-8-oxooctanoate?
The IUPAC name of methyl 8-[(2E)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-8-oxooctanoate (CID 23807492) is methyl 8-[(2E)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-8-oxooctanoate.
What is the SMILES notation for methyl 8-[(2E)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-8-oxooctanoate?
The canonical SMILES for methyl 8-[(2E)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-8-oxooctanoate is COC(=O)CCCCCCC(=O)N/N=C/c1cc(OC)c(OC)cc1[N+](=O)[O-].
What is the InChIKey of methyl 8-[(2E)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-8-oxooctanoate?
The InChIKey is WSLQLRCUNJXGFU-XDHOZWIPSA-N. The full InChI is InChI=1S/C18H25N3O7/c1-26-15-10-13(14(21(24)25)11-16(15)27-2)12-19-20-17(22)8-6-4-5-7-9-18(23)28-3/h10-12H,4-9H2,1-3H3,(H,20,22)/b19-12+.
What are the key properties of methyl 8-[(2E)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-8-oxooctanoate?
methyl 8-[(2E)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-8-oxooctanoate has a molecular weight of 395.41 g/mol, XLogP of 2.58, 12 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for methyl 8-[(2E)-2-[(4,5-dimethoxy-2-nitrophenyl)methylidene]hydrazinyl]-8-oxooctanoate is sourced from PubChem (CID 23807492), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).