C12H13Br2NO5 — CID 23807562
(E,4R,5R)-5-(3,5-dibromo-2-hydroxyphenyl)-N,5-dihydroxy-4-methoxypent-2-enamide (PubChem CID 23807562) has the molecular formula C12H13Br2NO5 and a molecular weight of 411.05 g/mol. Its IUPAC name is (E,4R,5R)-5-(3,5-dibromo-2-hydroxyphenyl)-N,5-dihydroxy-4-methoxypent-2-enamide.
| Compound Name | (E,4R,5R)-5-(3,5-dibromo-2-hydroxyphenyl)-N,5-dihydroxy-4-methoxypent-2-enamide |
|---|---|
| PubChem CID | 23807562 |
| Molecular Formula | C12H13Br2NO5 |
| Molecular Weight | 411.05 g/mol |
| Exact Mass | 408.92 |
| IUPAC Name | (E,4R,5R)-5-(3,5-dibromo-2-hydroxyphenyl)-N,5-dihydroxy-4-methoxypent-2-enamide |
| SMILES | CO[C@H](/C=C/C(=O)NO)[C@H](O)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C12H13Br2NO5/c1-20-9(2-3-10(16)15-19)12(18)7-4-6(13)5-8(14)11(7)17/h2-5,9,12,17-19H,1H3,(H,15,16)/b3-2+/t9-,12-/m1/s1 |
| InChIKey | MRHDNNWTZXQQSE-LUCSPQJISA-N |
| XLogP | 2.03 |
| TPSA | 99.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.05 |
| LogP ≤ 5 | 2.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|