C15H19Br2NO4 — CID 23807565
(E,7R)-7-(3,5-dibromo-2-hydroxyphenyl)-N,7-dihydroxy-6,6-dimethylhept-2-enamide (PubChem CID 23807565) has the molecular formula C15H19Br2NO4 and a molecular weight of 437.13 g/mol. Its IUPAC name is (E,7R)-7-(3,5-dibromo-2-hydroxyphenyl)-N,7-dihydroxy-6,6-dimethylhept-2-enamide.
| Compound Name | (E,7R)-7-(3,5-dibromo-2-hydroxyphenyl)-N,7-dihydroxy-6,6-dimethylhept-2-enamide |
|---|---|
| PubChem CID | 23807565 |
| Molecular Formula | C15H19Br2NO4 |
| Molecular Weight | 437.13 g/mol |
| Exact Mass | 434.97 |
| IUPAC Name | (E,7R)-7-(3,5-dibromo-2-hydroxyphenyl)-N,7-dihydroxy-6,6-dimethylhept-2-enamide |
| SMILES | CC(C)(CC/C=C/C(=O)NO)[C@@H](O)c1cc(Br)cc(Br)c1O |
| InChI | InChI=1S/C15H19Br2NO4/c1-15(2,6-4-3-5-12(19)18-22)14(21)10-7-9(16)8-11(17)13(10)20/h3,5,7-8,14,20-22H,4,6H2,1-2H3,(H,18,19)/b5-3+/t14-/m0/s1 |
| InChIKey | TUXHHOTVJNAANE-KQIUPUNMSA-N |
| XLogP | 3.82 |
| TPSA | 89.79 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.13 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|