C12H13FO4 — CID 23807577
(E,4R,5S)-5-(3-fluoro-4-hydroxyphenyl)-5-hydroxy-4-methylpent-2-enoic acid (PubChem CID 23807577) has the molecular formula C12H13FO4 and a molecular weight of 240.23 g/mol. Its IUPAC name is (E,4R,5S)-5-(3-fluoro-4-hydroxyphenyl)-5-hydroxy-4-methylpent-2-enoic acid.
| Compound Name | (E,4R,5S)-5-(3-fluoro-4-hydroxyphenyl)-5-hydroxy-4-methylpent-2-enoic acid |
|---|---|
| PubChem CID | 23807577 |
| Molecular Formula | C12H13FO4 |
| Molecular Weight | 240.23 g/mol |
| Exact Mass | 240.08 |
| IUPAC Name | (E,4R,5S)-5-(3-fluoro-4-hydroxyphenyl)-5-hydroxy-4-methylpent-2-enoic acid |
| SMILES | C[C@H](/C=C/C(=O)O)[C@H](O)c1ccc(O)c(F)c1 |
| InChI | InChI=1S/C12H13FO4/c1-7(2-5-11(15)16)12(17)8-3-4-10(14)9(13)6-8/h2-7,12,14,17H,1H3,(H,15,16)/b5-2+/t7-,12+/m1/s1 |
| InChIKey | UGFJPHBWNXAQGZ-USQKJFKDSA-N |
| XLogP | 1.84 |
| TPSA | 77.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.23 |
| LogP ≤ 5 | 1.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|