About 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzonitrile
4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzonitrile (PubChem CID 2380776) has the molecular formula C11H10N4S
and a molecular weight of 230.30 g/mol. Its IUPAC name is 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzonitrile.
Molecular Properties
| Compound Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzonitrile |
| PubChem CID | 2380776 |
| Molecular Formula | C11H10N4S |
| Molecular Weight | 230.30 g/mol |
| Exact Mass | 230.06 |
| IUPAC Name | 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzonitrile |
| SMILES | Cn1cnnc1SCc1ccc(C#N)cc1 |
| InChI | InChI=1S/C11H10N4S/c1-15-8-13-14-11(15)16-7-10-4-2-9(6-12)3-5-10/h2-5,8H,7H2,1H3 |
| InChIKey | QHKLSHIFWYJFFL-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.30 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzonitrile?
The IUPAC name of 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzonitrile (CID 2380776) is 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzonitrile.
What is the SMILES notation for 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzonitrile?
The canonical SMILES for 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzonitrile is Cn1cnnc1SCc1ccc(C#N)cc1.
What is the InChIKey of 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzonitrile?
The InChIKey is QHKLSHIFWYJFFL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H10N4S/c1-15-8-13-14-11(15)16-7-10-4-2-9(6-12)3-5-10/h2-5,8H,7H2,1H3.
What are the key properties of 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzonitrile?
4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzonitrile has a molecular weight of 230.30 g/mol, XLogP of 1.98, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 4-[(4-methyl-1,2,4-triazol-3-yl)sulfanylmethyl]benzonitrile is sourced from PubChem (CID 2380776), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).