C34H47N3O5 — CID 23811460
(5R,6S,7S)-2-N-cyclohexyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23811460) has the molecular formula C34H47N3O5 and a molecular weight of 577.77 g/mol. Its IUPAC name is (5R,6S,7S)-2-N-cyclohexyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5R,6S,7S)-2-N-cyclohexyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23811460 |
| Molecular Formula | C34H47N3O5 |
| Molecular Weight | 577.77 g/mol |
| Exact Mass | 577.35 |
| IUPAC Name | (5R,6S,7S)-2-N-cyclohexyl-3-[(2R)-1-hydroxy-3-phenylpropan-2-yl]-4-oxo-2-N,6-N-bis(prop-2-enyl)-6-N-propyl-10-oxa-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCC)C(=O)[C@@H]1[C@@H]2CCC3(O2)C(C(=O)N(CC=C)C2CCCCC2)N([C@@H](CO)Cc2ccccc2)C(=O)[C@H]13 |
| InChI | InChI=1S/C34H47N3O5/c1-4-19-35(20-5-2)31(39)28-27-17-18-34(42-27)29(28)32(40)37(26(23-38)22-24-13-9-7-10-14-24)30(34)33(41)36(21-6-3)25-15-11-8-12-16-25/h4,6-7,9-10,13-14,25-30,38H,1,3,5,8,11-12,15-23H2,2H3/t26-,27+,28-,29+,30?,34?/m1/s1 |
| InChIKey | AVPVBEJBOQNHKQ-RUSRRYBASA-N |
| XLogP | 3.74 |
| TPSA | 90.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 577.77 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|