C32H44N4O5S — CID 23812116
(5S,6R,7S)-3-[(2R)-1-hydroxypropan-2-yl]-7-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide (PubChem CID 23812116) has the molecular formula C32H44N4O5S and a molecular weight of 596.79 g/mol. Its IUPAC name is (5S,6R,7S)-3-[(2R)-1-hydroxypropan-2-yl]-7-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide.
| Compound Name | (5S,6R,7S)-3-[(2R)-1-hydroxypropan-2-yl]-7-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
|---|---|
| PubChem CID | 23812116 |
| Molecular Formula | C32H44N4O5S |
| Molecular Weight | 596.79 g/mol |
| Exact Mass | 596.30 |
| IUPAC Name | (5S,6R,7S)-3-[(2R)-1-hydroxypropan-2-yl]-7-methyl-2-N-(2-morpholin-4-ylethyl)-4-oxo-6-N-phenyl-2-N,6-N-bis(prop-2-enyl)-10-thia-3-azatricyclo[5.2.1.01,5]decane-2,6-dicarboxamide |
| SMILES | C=CCN(CCN1CCOCC1)C(=O)C1N([C@H](C)CO)C(=O)[C@@H]2[C@H](C(=O)N(CC=C)c3ccccc3)[C@]3(C)CCC12S3 |
| InChI | InChI=1S/C32H44N4O5S/c1-5-14-34(17-16-33-18-20-41-21-19-33)30(40)27-32-13-12-31(4,42-32)25(26(32)29(39)36(27)23(3)22-37)28(38)35(15-6-2)24-10-8-7-9-11-24/h5-11,23,25-27,37H,1-2,12-22H2,3-4H3/t23-,25-,26+,27?,31+,32?/m1/s1 |
| InChIKey | QQEMVWQLASVGAH-XJSVKQIYSA-N |
| XLogP | 2.41 |
| TPSA | 93.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.79 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|