C20H32O5 — CID 23815278
2-[(2R,5S,8aR)-5-(carboxymethyl)-2-ethenyl-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydrochromen-6-yl]-2-methylpropanoic acid (PubChem CID 23815278) has the molecular formula C20H32O5 and a molecular weight of 352.47 g/mol. Its IUPAC name is 2-[(2R,5S,8aR)-5-(carboxymethyl)-2-ethenyl-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydrochromen-6-yl]-2-methylpropanoic acid.
| Compound Name | 2-[(2R,5S,8aR)-5-(carboxymethyl)-2-ethenyl-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydrochromen-6-yl]-2-methylpropanoic acid |
|---|---|
| PubChem CID | 23815278 |
| Molecular Formula | C20H32O5 |
| Molecular Weight | 352.47 g/mol |
| Exact Mass | 352.22 |
| IUPAC Name | 2-[(2R,5S,8aR)-5-(carboxymethyl)-2-ethenyl-2,5,8a-trimethyl-3,4,4a,6,7,8-hexahydrochromen-6-yl]-2-methylpropanoic acid |
| SMILES | C=C[C@@]1(C)CCC2[C@@](C)(CC(=O)O)C(C(C)(C)C(=O)O)CC[C@@]2(C)O1 |
| InChI | InChI=1S/C20H32O5/c1-7-18(4)10-8-14-19(5,12-15(21)22)13(17(2,3)16(23)24)9-11-20(14,6)25-18/h7,13-14H,1,8-12H2,2-6H3,(H,21,22)(H,23,24)/t13?,14?,18-,19-,20+/m0/s1 |
| InChIKey | SNSXKAUSYCGEJL-JQAMBQSKSA-N |
| XLogP | 4.12 |
| TPSA | 83.83 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.47 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|