C23H30N2O6Si — CID 23815559
(3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-(3-methoxy-2-oxo-1-pyridinyl)-1,3'-dimethylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23815559) has the molecular formula C23H30N2O6Si and a molecular weight of 458.59 g/mol. Its IUPAC name is (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-(3-methoxy-2-oxo-1-pyridinyl)-1,3'-dimethylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-(3-methoxy-2-oxo-1-pyridinyl)-1,3'-dimethylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23815559 |
| Molecular Formula | C23H30N2O6Si |
| Molecular Weight | 458.59 g/mol |
| Exact Mass | 458.19 |
| IUPAC Name | (3R,3'R,4'S,5'R)-4'-[hydroxy(dimethyl)silyl]-5'-(2-hydroxyethyl)-5-(3-methoxy-2-oxo-1-pyridinyl)-1,3'-dimethylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | COc1cccn(-c2ccc3c(c2)[C@@]2(O[C@H](CCO)[C@@H]([Si](C)(C)O)[C@@H]2C)C(=O)N3C)c1=O |
| InChI | InChI=1S/C23H30N2O6Si/c1-14-20(32(4,5)29)18(10-12-26)31-23(14)16-13-15(8-9-17(16)24(2)22(23)28)25-11-6-7-19(30-3)21(25)27/h6-9,11,13-14,18,20,26,29H,10,12H2,1-5H3/t14-,18+,20-,23+/m0/s1 |
| InChIKey | QVCHVGJRZGFTNL-OMABIOOLSA-N |
| XLogP | 2.00 |
| TPSA | 101.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.59 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|