C35H41FN4O4Si — CID 23815883
(3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one (PubChem CID 23815883) has the molecular formula C35H41FN4O4Si and a molecular weight of 628.82 g/mol. Its IUPAC name is (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one.
| Compound Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one |
|---|---|
| PubChem CID | 23815883 |
| Molecular Formula | C35H41FN4O4Si |
| Molecular Weight | 628.82 g/mol |
| Exact Mass | 628.29 |
| IUPAC Name | (3S,3'S,4'R,5'S)-4'-[fluoro(dimethyl)silyl]-5'-(2-hydroxyethyl)-3'-methyl-5-(4-oxo-1-phenyl-1,3,8-triazaspiro[4.5]decan-3-yl)-1-phenylspiro[indole-3,2'-oxolane]-2-one |
| SMILES | C[C@@H]1[C@@H]([Si](C)(C)F)[C@H](CCO)O[C@@]12C(=O)N(c1ccccc1)c1ccc(N3CN(c4ccccc4)C4(CCNCC4)C3=O)cc12 |
| InChI | InChI=1S/C35H41FN4O4Si/c1-24-31(45(2,3)36)30(16-21-41)44-35(24)28-22-27(14-15-29(28)40(33(35)43)26-12-8-5-9-13-26)38-23-39(25-10-6-4-7-11-25)34(32(38)42)17-19-37-20-18-34/h4-15,22,24,30-31,37,41H,16-21,23H2,1-3H3/t24-,30+,31-,35+/m1/s1 |
| InChIKey | FRSPFSFEAPQLKD-RGJUWZDXSA-N |
| XLogP | 5.46 |
| TPSA | 85.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 628.82 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|