C22H37N7O4 — CID 23816485
4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-N-butyl-2-N-[(2,3-dimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine (PubChem CID 23816485) has the molecular formula C22H37N7O4 and a molecular weight of 463.58 g/mol. Its IUPAC name is 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-N-butyl-2-N-[(2,3-dimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine.
| Compound Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-N-butyl-2-N-[(2,3-dimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
|---|---|
| PubChem CID | 23816485 |
| Molecular Formula | C22H37N7O4 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.29 |
| IUPAC Name | 4-N-[2-[2-(2-aminoethoxy)ethoxy]ethyl]-6-N-butyl-2-N-[(2,3-dimethoxyphenyl)methyl]-1,3,5-triazine-2,4,6-triamine |
| SMILES | CCCCNc1nc(NCCOCCOCCN)nc(NCc2cccc(OC)c2OC)n1 |
| InChI | InChI=1S/C22H37N7O4/c1-4-5-10-24-20-27-21(25-11-13-33-15-14-32-12-9-23)29-22(28-20)26-16-17-7-6-8-18(30-2)19(17)31-3/h6-8H,4-5,9-16,23H2,1-3H3,(H3,24,25,26,27,28,29) |
| InChIKey | IASBPROFUZWEIY-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 137.70 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|