About 2-[2,6-bis[(E)-2-(2,5-difluorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine
2-[2,6-bis[(E)-2-(2,5-difluorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine (PubChem CID 23816671) has the molecular formula C23H19F4N2+
and a molecular weight of 399.41 g/mol. Its IUPAC name is 2-[2,6-bis[(E)-2-(2,5-difluorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine.
Molecular Properties
| Compound Name | 2-[2,6-bis[(E)-2-(2,5-difluorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine |
| PubChem CID | 23816671 |
| Molecular Formula | C23H19F4N2+ |
| Molecular Weight | 399.41 g/mol |
| Exact Mass | 399.15 |
| IUPAC Name | 2-[2,6-bis[(E)-2-(2,5-difluorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine |
| SMILES | NCC[n+]1c(/C=C/c2cc(F)ccc2F)cccc1/C=C/c1cc(F)ccc1F |
| InChI | InChI=1S/C23H19F4N2/c24-18-6-10-22(26)16(14-18)4-8-20-2-1-3-21(29(20)13-12-28)9-5-17-15-19(25)7-11-23(17)27/h1-11,14-15H,12-13,28H2/q+1/b8-4+,9-5+ |
| InChIKey | HIEKWDRETXWEEH-KBXRYBNXSA-N |
| XLogP | 4.83 |
| TPSA | 29.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 399.41 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 2-[2,6-bis[(E)-2-(2,5-difluorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2,6-bis[(E)-2-(2,5-difluorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine?
The IUPAC name of 2-[2,6-bis[(E)-2-(2,5-difluorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine (CID 23816671) is 2-[2,6-bis[(E)-2-(2,5-difluorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine.
What is the SMILES notation for 2-[2,6-bis[(E)-2-(2,5-difluorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine?
The canonical SMILES for 2-[2,6-bis[(E)-2-(2,5-difluorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine is NCC[n+]1c(/C=C/c2cc(F)ccc2F)cccc1/C=C/c1cc(F)ccc1F.
What is the InChIKey of 2-[2,6-bis[(E)-2-(2,5-difluorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine?
The InChIKey is HIEKWDRETXWEEH-KBXRYBNXSA-N. The full InChI is InChI=1S/C23H19F4N2/c24-18-6-10-22(26)16(14-18)4-8-20-2-1-3-21(29(20)13-12-28)9-5-17-15-19(25)7-11-23(17)27/h1-11,14-15H,12-13,28H2/q+1/b8-4+,9-5+.
What are the key properties of 2-[2,6-bis[(E)-2-(2,5-difluorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine?
2-[2,6-bis[(E)-2-(2,5-difluorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine has a molecular weight of 399.41 g/mol, XLogP of 4.83, 6 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2,6-bis[(E)-2-(2,5-difluorophenyl)ethenyl]pyridin-1-ium-1-yl]ethanamine is sourced from PubChem (CID 23816671), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).