C23H30FNO4Si — CID 23817335
N-[(2S,3S,4S)-2-[1-[fluoro(dimethyl)silyl]-3-hydroxypropyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]-N-phenylformamide (PubChem CID 23817335) has the molecular formula C23H30FNO4Si and a molecular weight of 431.58 g/mol. Its IUPAC name is N-[(2S,3S,4S)-2-[1-[fluoro(dimethyl)silyl]-3-hydroxypropyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]-N-phenylformamide.
| Compound Name | N-[(2S,3S,4S)-2-[1-[fluoro(dimethyl)silyl]-3-hydroxypropyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]-N-phenylformamide |
|---|---|
| PubChem CID | 23817335 |
| Molecular Formula | C23H30FNO4Si |
| Molecular Weight | 431.58 g/mol |
| Exact Mass | 431.19 |
| IUPAC Name | N-[(2S,3S,4S)-2-[1-[fluoro(dimethyl)silyl]-3-hydroxypropyl]-4-methoxy-3-methyl-3,4-dihydro-2H-chromen-6-yl]-N-phenylformamide |
| SMILES | CO[C@@H]1c2cc(N(C=O)c3ccccc3)ccc2O[C@H](C(CCO)[Si](C)(C)F)[C@H]1C |
| InChI | InChI=1S/C23H30FNO4Si/c1-16-22(28-2)19-14-18(25(15-27)17-8-6-5-7-9-17)10-11-20(19)29-23(16)21(12-13-26)30(3,4)24/h5-11,14-16,21-23,26H,12-13H2,1-4H3/t16-,21?,22-,23-/m0/s1 |
| InChIKey | RFPZNOYHYONONV-CJEYXRJBSA-N |
| XLogP | 4.99 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.58 |
| LogP ≤ 5 | 4.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|