C26H36FNO3Si — CID 23817413
N-benzyl-2-[(2R,3S,4R,5S)-3-[fluoro(dimethyl)silyl]-4-methyl-5-(2-phenylethyl)oxolan-2-yl]-N-(2-hydroxyethyl)acetamide (PubChem CID 23817413) has the molecular formula C26H36FNO3Si and a molecular weight of 457.66 g/mol. Its IUPAC name is N-benzyl-2-[(2R,3S,4R,5S)-3-[fluoro(dimethyl)silyl]-4-methyl-5-(2-phenylethyl)oxolan-2-yl]-N-(2-hydroxyethyl)acetamide.
| Compound Name | N-benzyl-2-[(2R,3S,4R,5S)-3-[fluoro(dimethyl)silyl]-4-methyl-5-(2-phenylethyl)oxolan-2-yl]-N-(2-hydroxyethyl)acetamide |
|---|---|
| PubChem CID | 23817413 |
| Molecular Formula | C26H36FNO3Si |
| Molecular Weight | 457.66 g/mol |
| Exact Mass | 457.24 |
| IUPAC Name | N-benzyl-2-[(2R,3S,4R,5S)-3-[fluoro(dimethyl)silyl]-4-methyl-5-(2-phenylethyl)oxolan-2-yl]-N-(2-hydroxyethyl)acetamide |
| SMILES | C[C@H]1[C@H]([Si](C)(C)F)[C@@H](CC(=O)N(CCO)Cc2ccccc2)O[C@H]1CCc1ccccc1 |
| InChI | InChI=1S/C26H36FNO3Si/c1-20-23(15-14-21-10-6-4-7-11-21)31-24(26(20)32(2,3)27)18-25(30)28(16-17-29)19-22-12-8-5-9-13-22/h4-13,20,23-24,26,29H,14-19H2,1-3H3/t20-,23+,24-,26+/m1/s1 |
| InChIKey | UBTPBZIHWDDSIP-UWIXBZKZSA-N |
| XLogP | 4.98 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.66 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'silicon_halogen', 'substructure': 'N/A'} |
|---|