C21H30O8 — CID 23817929
(3,4,5-trihydroxy-6-methyloxan-2-yl) 1,8,8-trimethyl-3-oxo-1,4,4a,6a,7,9-hexahydropentaleno[6a,1-c]pyran-5-carboxylate (PubChem CID 23817929) has the molecular formula C21H30O8 and a molecular weight of 410.46 g/mol. Its IUPAC name is (3,4,5-trihydroxy-6-methyloxan-2-yl) 1,8,8-trimethyl-3-oxo-1,4,4a,6a,7,9-hexahydropentaleno[6a,1-c]pyran-5-carboxylate.
| Compound Name | (3,4,5-trihydroxy-6-methyloxan-2-yl) 1,8,8-trimethyl-3-oxo-1,4,4a,6a,7,9-hexahydropentaleno[6a,1-c]pyran-5-carboxylate |
|---|---|
| PubChem CID | 23817929 |
| Molecular Formula | C21H30O8 |
| Molecular Weight | 410.46 g/mol |
| Exact Mass | 410.19 |
| IUPAC Name | (3,4,5-trihydroxy-6-methyloxan-2-yl) 1,8,8-trimethyl-3-oxo-1,4,4a,6a,7,9-hexahydropentaleno[6a,1-c]pyran-5-carboxylate |
| SMILES | CC1OC(OC(=O)C2=CC3CC(C)(C)CC34C(C)OC(=O)CC24)C(O)C(O)C1O |
| InChI | InChI=1S/C21H30O8/c1-9-15(23)16(24)17(25)19(27-9)29-18(26)12-5-11-7-20(3,4)8-21(11)10(2)28-14(22)6-13(12)21/h5,9-11,13,15-17,19,23-25H,6-8H2,1-4H3 |
| InChIKey | WMKFUKIIXMHXAL-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 122.52 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.46 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |