C24H23NO4 — CID 23818312
aziridin-1-yl-[(2R,4R)-4-(4-ethynylphenyl)-2-[[4-(hydroxymethyl)phenyl]methoxy]-3,4-dihydro-2H-pyran-6-yl]methanone (PubChem CID 23818312) has the molecular formula C24H23NO4 and a molecular weight of 389.45 g/mol. Its IUPAC name is aziridin-1-yl-[(2R,4R)-4-(4-ethynylphenyl)-2-[[4-(hydroxymethyl)phenyl]methoxy]-3,4-dihydro-2H-pyran-6-yl]methanone.
| Compound Name | aziridin-1-yl-[(2R,4R)-4-(4-ethynylphenyl)-2-[[4-(hydroxymethyl)phenyl]methoxy]-3,4-dihydro-2H-pyran-6-yl]methanone |
|---|---|
| PubChem CID | 23818312 |
| Molecular Formula | C24H23NO4 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.16 |
| IUPAC Name | aziridin-1-yl-[(2R,4R)-4-(4-ethynylphenyl)-2-[[4-(hydroxymethyl)phenyl]methoxy]-3,4-dihydro-2H-pyran-6-yl]methanone |
| SMILES | C#Cc1ccc([C@H]2C=C(C(=O)N3CC3)O[C@@H](OCc3ccc(CO)cc3)C2)cc1 |
| InChI | InChI=1S/C24H23NO4/c1-2-17-7-9-20(10-8-17)21-13-22(24(27)25-11-12-25)29-23(14-21)28-16-19-5-3-18(15-26)4-6-19/h1,3-10,13,21,23,26H,11-12,14-16H2/t21-,23+/m0/s1 |
| InChIKey | QLOMONMNMSTYEY-JTHBVZDNSA-N |
| XLogP | 2.93 |
| TPSA | 58.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|