C24H26N4OS2 — CID 23818616
3-benzylsulfanyl-8-cyclohexyl-10-thia-2,4,5,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),3,5,11(16)-tetraen-7-one (PubChem CID 23818616) has the molecular formula C24H26N4OS2 and a molecular weight of 450.63 g/mol. Its IUPAC name is 3-benzylsulfanyl-8-cyclohexyl-10-thia-2,4,5,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),3,5,11(16)-tetraen-7-one.
| Compound Name | 3-benzylsulfanyl-8-cyclohexyl-10-thia-2,4,5,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),3,5,11(16)-tetraen-7-one |
|---|---|
| PubChem CID | 23818616 |
| Molecular Formula | C24H26N4OS2 |
| Molecular Weight | 450.63 g/mol |
| Exact Mass | 450.15 |
| IUPAC Name | 3-benzylsulfanyl-8-cyclohexyl-10-thia-2,4,5,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),3,5,11(16)-tetraen-7-one |
| SMILES | O=c1c2nnc(SCc3ccccc3)n2c2c3c(sc2n1C1CCCCC1)CCCC3 |
| InChI | InChI=1S/C24H26N4OS2/c29-22-21-25-26-24(30-15-16-9-3-1-4-10-16)28(21)20-18-13-7-8-14-19(18)31-23(20)27(22)17-11-5-2-6-12-17/h1,3-4,9-10,17H,2,5-8,11-15H2 |
| InChIKey | UZLIMTOYNDQRMB-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 52.19 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.63 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |