C14H22N2 — CID 23819708
2,2,4,6,7-pentamethyl-1,3-dihydroquinolin-4-amine (PubChem CID 23819708) has the molecular formula C14H22N2 and a molecular weight of 218.34 g/mol. Its IUPAC name is 2,2,4,6,7-pentamethyl-1,3-dihydroquinolin-4-amine.
| Compound Name | 2,2,4,6,7-pentamethyl-1,3-dihydroquinolin-4-amine |
|---|---|
| PubChem CID | 23819708 |
| Molecular Formula | C14H22N2 |
| Molecular Weight | 218.34 g/mol |
| Exact Mass | 218.18 |
| IUPAC Name | 2,2,4,6,7-pentamethyl-1,3-dihydroquinolin-4-amine |
| SMILES | Cc1cc2c(cc1C)C(C)(N)CC(C)(C)N2 |
| InChI | InChI=1S/C14H22N2/c1-9-6-11-12(7-10(9)2)16-13(3,4)8-14(11,5)15/h6-7,16H,8,15H2,1-5H3 |
| InChIKey | UCIHEGNMGBECSR-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 218.34 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |