C21H25N3OS — CID 23821632
1-(2-cyanoethyl)-3-(2,6-diethylphenyl)-1-(2-methoxyphenyl)thiourea (PubChem CID 23821632) has the molecular formula C21H25N3OS and a molecular weight of 367.52 g/mol. Its IUPAC name is 1-(2-cyanoethyl)-3-(2,6-diethylphenyl)-1-(2-methoxyphenyl)thiourea.
| Compound Name | 1-(2-cyanoethyl)-3-(2,6-diethylphenyl)-1-(2-methoxyphenyl)thiourea |
|---|---|
| PubChem CID | 23821632 |
| Molecular Formula | C21H25N3OS |
| Molecular Weight | 367.52 g/mol |
| Exact Mass | 367.17 |
| IUPAC Name | 1-(2-cyanoethyl)-3-(2,6-diethylphenyl)-1-(2-methoxyphenyl)thiourea |
| SMILES | CCc1cccc(CC)c1NC(=S)N(CCC#N)c1ccccc1OC |
| InChI | InChI=1S/C21H25N3OS/c1-4-16-10-8-11-17(5-2)20(16)23-21(26)24(15-9-14-22)18-12-6-7-13-19(18)25-3/h6-8,10-13H,4-5,9,15H2,1-3H3,(H,23,26) |
| InChIKey | RVERHHYAIHCUAR-UHFFFAOYSA-N |
| XLogP | 4.94 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.52 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|