C23H16N4O7 — CID 23822408
5-(3-nitrophenyl)-3-(4-nitrophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione (PubChem CID 23822408) has the molecular formula C23H16N4O7 and a molecular weight of 460.40 g/mol. Its IUPAC name is 5-(3-nitrophenyl)-3-(4-nitrophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione.
| Compound Name | 5-(3-nitrophenyl)-3-(4-nitrophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
|---|---|
| PubChem CID | 23822408 |
| Molecular Formula | C23H16N4O7 |
| Molecular Weight | 460.40 g/mol |
| Exact Mass | 460.10 |
| IUPAC Name | 5-(3-nitrophenyl)-3-(4-nitrophenyl)-2-phenyl-3a,6a-dihydro-3H-pyrrolo[3,4-d][1,2]oxazole-4,6-dione |
| SMILES | O=C1C2ON(c3ccccc3)C(c3ccc([N+](=O)[O-])cc3)C2C(=O)N1c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C23H16N4O7/c28-22-19-20(14-9-11-16(12-10-14)26(30)31)25(15-5-2-1-3-6-15)34-21(19)23(29)24(22)17-7-4-8-18(13-17)27(32)33/h1-13,19-21H |
| InChIKey | XBMHBHPLTDXNLO-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 136.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 460.40 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|