C17H27N3OS — CID 23822864
3-[2-(diethylamino)ethyl]-2-[4-(dimethylamino)phenyl]-1,3-thiazolidin-4-one (PubChem CID 23822864) has the molecular formula C17H27N3OS and a molecular weight of 321.49 g/mol. Its IUPAC name is 3-[2-(diethylamino)ethyl]-2-[4-(dimethylamino)phenyl]-1,3-thiazolidin-4-one.
| Compound Name | 3-[2-(diethylamino)ethyl]-2-[4-(dimethylamino)phenyl]-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 23822864 |
| Molecular Formula | C17H27N3OS |
| Molecular Weight | 321.49 g/mol |
| Exact Mass | 321.19 |
| IUPAC Name | 3-[2-(diethylamino)ethyl]-2-[4-(dimethylamino)phenyl]-1,3-thiazolidin-4-one |
| SMILES | CCN(CC)CCN1C(=O)CSC1c1ccc(N(C)C)cc1 |
| InChI | InChI=1S/C17H27N3OS/c1-5-19(6-2)11-12-20-16(21)13-22-17(20)14-7-9-15(10-8-14)18(3)4/h7-10,17H,5-6,11-13H2,1-4H3 |
| InChIKey | JUCFDLIZJPVFER-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.49 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_D(198)', 'substructure': 'N/A'} |
|---|