C7H5Cl3 — CID 23823
1,2,3-trichloro-4-methylbenzene (PubChem CID 23823) has the molecular formula C7H5Cl3 and a molecular weight of 195.48 g/mol. Its IUPAC name is 1,2,3-trichloro-4-methylbenzene.
| Compound Name | 1,2,3-trichloro-4-methylbenzene |
|---|---|
| PubChem CID | 23823 |
| Molecular Formula | C7H5Cl3 |
| Molecular Weight | 195.48 g/mol |
| Exact Mass | 193.95 |
| IUPAC Name | 1,2,3-trichloro-4-methylbenzene |
| SMILES | Cc1ccc(Cl)c(Cl)c1Cl |
| InChI | InChI=1S/C7H5Cl3/c1-4-2-3-5(8)7(10)6(4)9/h2-3H,1H3 |
| InChIKey | LHOGNQZQKDZOBP-UHFFFAOYSA-N |
| XLogP | 3.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.48 |
| LogP ≤ 5 | 3.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|