C14H9N3OS — CID 23824058
4-methyl-15-thia-8,12,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1,3,5,7,9,13,16-heptaen-11-one (PubChem CID 23824058) has the molecular formula C14H9N3OS and a molecular weight of 267.31 g/mol. Its IUPAC name is 4-methyl-15-thia-8,12,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1,3,5,7,9,13,16-heptaen-11-one.
| Compound Name | 4-methyl-15-thia-8,12,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1,3,5,7,9,13,16-heptaen-11-one |
|---|---|
| PubChem CID | 23824058 |
| Molecular Formula | C14H9N3OS |
| Molecular Weight | 267.31 g/mol |
| Exact Mass | 267.05 |
| IUPAC Name | 4-methyl-15-thia-8,12,17-triazatetracyclo[8.7.0.02,7.012,16]heptadeca-1,3,5,7,9,13,16-heptaen-11-one |
| SMILES | Cc1ccc2ncc3c(=O)n4ccsc4nc3c2c1 |
| InChI | InChI=1S/C14H9N3OS/c1-8-2-3-11-9(6-8)12-10(7-15-11)13(18)17-4-5-19-14(17)16-12/h2-7H,1H3 |
| InChIKey | PYUYACWXTKZUEQ-UHFFFAOYSA-N |
| XLogP | 2.77 |
| TPSA | 47.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.31 |
| LogP ≤ 5 | 2.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|