C21H19N3O3S — CID 23824107
3-(1,3-benzodioxol-5-ylmethylideneamino)-4-(4-methoxyphenyl)-N-prop-2-enyl-1,3-thiazol-2-imine (PubChem CID 23824107) has the molecular formula C21H19N3O3S and a molecular weight of 393.47 g/mol. Its IUPAC name is 3-(1,3-benzodioxol-5-ylmethylideneamino)-4-(4-methoxyphenyl)-N-prop-2-enyl-1,3-thiazol-2-imine.
| Compound Name | 3-(1,3-benzodioxol-5-ylmethylideneamino)-4-(4-methoxyphenyl)-N-prop-2-enyl-1,3-thiazol-2-imine |
|---|---|
| PubChem CID | 23824107 |
| Molecular Formula | C21H19N3O3S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | 3-(1,3-benzodioxol-5-ylmethylideneamino)-4-(4-methoxyphenyl)-N-prop-2-enyl-1,3-thiazol-2-imine |
| SMILES | C=CC/N=c1\scc(-c2ccc(OC)cc2)n1N=Cc1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C21H19N3O3S/c1-3-10-22-21-24(18(13-28-21)16-5-7-17(25-2)8-6-16)23-12-15-4-9-19-20(11-15)27-14-26-19/h3-9,11-13H,1,10,14H2,2H3/b22-21-,23-12? |
| InChIKey | KKEJNSQPZKDWFF-XTWJKVAUSA-N |
| XLogP | 3.92 |
| TPSA | 57.34 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|