C15H15BrN2O2S — CID 23825003
10-(5-bromo-2-hydroxyphenyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodec-2(6)-en-12-one (PubChem CID 23825003) has the molecular formula C15H15BrN2O2S and a molecular weight of 367.27 g/mol. Its IUPAC name is 10-(5-bromo-2-hydroxyphenyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodec-2(6)-en-12-one.
| Compound Name | 10-(5-bromo-2-hydroxyphenyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodec-2(6)-en-12-one |
|---|---|
| PubChem CID | 23825003 |
| Molecular Formula | C15H15BrN2O2S |
| Molecular Weight | 367.27 g/mol |
| Exact Mass | 366.00 |
| IUPAC Name | 10-(5-bromo-2-hydroxyphenyl)-7-thia-9,11-diazatricyclo[6.4.0.02,6]dodec-2(6)-en-12-one |
| SMILES | O=C1NC(c2cc(Br)ccc2O)NC2SC3=C(CCC3)C12 |
| InChI | InChI=1S/C15H15BrN2O2S/c16-7-4-5-10(19)9(6-7)13-17-14(20)12-8-2-1-3-11(8)21-15(12)18-13/h4-6,12-13,15,18-19H,1-3H2,(H,17,20) |
| InChIKey | VCAULWZFLUZINA-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.27 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'} |
|---|