C24H33N3O4 — CID 23825810
(6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-[4-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,4-diazepan-1-yl]methanone (PubChem CID 23825810) has the molecular formula C24H33N3O4 and a molecular weight of 427.55 g/mol. Its IUPAC name is (6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-[4-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,4-diazepan-1-yl]methanone.
| Compound Name | (6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-[4-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,4-diazepan-1-yl]methanone |
|---|---|
| PubChem CID | 23825810 |
| Molecular Formula | C24H33N3O4 |
| Molecular Weight | 427.55 g/mol |
| Exact Mass | 427.25 |
| IUPAC Name | (6-hydroxy-2,5,7,8-tetramethyl-3,4-dihydrochromen-2-yl)-[4-[(5-methyl-1,2-oxazol-3-yl)methyl]-1,4-diazepan-1-yl]methanone |
| SMILES | Cc1cc(CN2CCCN(C(=O)C3(C)CCc4c(C)c(O)c(C)c(C)c4O3)CC2)no1 |
| InChI | InChI=1S/C24H33N3O4/c1-15-13-19(25-31-15)14-26-9-6-10-27(12-11-26)23(29)24(5)8-7-20-18(4)21(28)16(2)17(3)22(20)30-24/h13,28H,6-12,14H2,1-5H3 |
| InChIKey | PJCBKACZTCYDND-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 79.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.55 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |