About N-(2,5-dimethylphenyl)-4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine
N-(2,5-dimethylphenyl)-4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine (PubChem CID 23826269) has the molecular formula C19H21N3S
and a molecular weight of 323.47 g/mol. Its IUPAC name is N-(2,5-dimethylphenyl)-4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine.
Molecular Properties
| Compound Name | N-(2,5-dimethylphenyl)-4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine |
| PubChem CID | 23826269 |
| Molecular Formula | C19H21N3S |
| Molecular Weight | 323.47 g/mol |
| Exact Mass | 323.15 |
| IUPAC Name | N-(2,5-dimethylphenyl)-4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine |
| SMILES | Cc1ccc(C)c(/N=c2\scc(C)n2CCc2ccccn2)c1 |
| InChI | InChI=1S/C19H21N3S/c1-14-7-8-15(2)18(12-14)21-19-22(16(3)13-23-19)11-9-17-6-4-5-10-20-17/h4-8,10,12-13H,9,11H2,1-3H3/b21-19- |
| InChIKey | YQMOLSWVJVSUQU-VZCXRCSSSA-N |
| XLogP | 4.34 |
| TPSA | 30.18 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 323.47 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiaz_ene_A(128)', 'substructure': 'N/A'} |
|---|
Analyze N-(2,5-dimethylphenyl)-4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2,5-dimethylphenyl)-4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine?
The IUPAC name of N-(2,5-dimethylphenyl)-4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine (CID 23826269) is N-(2,5-dimethylphenyl)-4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine.
What is the SMILES notation for N-(2,5-dimethylphenyl)-4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine?
The canonical SMILES for N-(2,5-dimethylphenyl)-4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine is Cc1ccc(C)c(/N=c2\scc(C)n2CCc2ccccn2)c1.
What is the InChIKey of N-(2,5-dimethylphenyl)-4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine?
The InChIKey is YQMOLSWVJVSUQU-VZCXRCSSSA-N. The full InChI is InChI=1S/C19H21N3S/c1-14-7-8-15(2)18(12-14)21-19-22(16(3)13-23-19)11-9-17-6-4-5-10-20-17/h4-8,10,12-13H,9,11H2,1-3H3/b21-19-.
What are the key properties of N-(2,5-dimethylphenyl)-4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine?
N-(2,5-dimethylphenyl)-4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine has a molecular weight of 323.47 g/mol, XLogP of 4.34, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2,5-dimethylphenyl)-4-methyl-3-(2-pyridin-2-ylethyl)-1,3-thiazol-2-imine is sourced from PubChem (CID 23826269), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).