C22H21N3O3 — CID 23827096
3-butyl-10-(2-methoxyphenyl)pyrimido[4,5-b]quinoline-2,4-dione (PubChem CID 23827096) has the molecular formula C22H21N3O3 and a molecular weight of 375.43 g/mol. Its IUPAC name is 3-butyl-10-(2-methoxyphenyl)pyrimido[4,5-b]quinoline-2,4-dione.
| Compound Name | 3-butyl-10-(2-methoxyphenyl)pyrimido[4,5-b]quinoline-2,4-dione |
|---|---|
| PubChem CID | 23827096 |
| Molecular Formula | C22H21N3O3 |
| Molecular Weight | 375.43 g/mol |
| Exact Mass | 375.16 |
| IUPAC Name | 3-butyl-10-(2-methoxyphenyl)pyrimido[4,5-b]quinoline-2,4-dione |
| SMILES | CCCCn1c(=O)nc2n(-c3ccccc3OC)c3ccccc3cc-2c1=O |
| InChI | InChI=1S/C22H21N3O3/c1-3-4-13-24-21(26)16-14-15-9-5-6-10-17(15)25(20(16)23-22(24)27)18-11-7-8-12-19(18)28-2/h5-12,14H,3-4,13H2,1-2H3 |
| InChIKey | HKUXEKSXIRQLKQ-UHFFFAOYSA-N |
| XLogP | 3.46 |
| TPSA | 66.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.43 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'} |
|---|