C15H14N2O4 — CID 23829003
5-ethyl-7,8-dimethoxypyrrolo[3,4-c]isoquinoline-1,3-dione (PubChem CID 23829003) has the molecular formula C15H14N2O4 and a molecular weight of 286.29 g/mol. Its IUPAC name is 5-ethyl-7,8-dimethoxypyrrolo[3,4-c]isoquinoline-1,3-dione.
| Compound Name | 5-ethyl-7,8-dimethoxypyrrolo[3,4-c]isoquinoline-1,3-dione |
|---|---|
| PubChem CID | 23829003 |
| Molecular Formula | C15H14N2O4 |
| Molecular Weight | 286.29 g/mol |
| Exact Mass | 286.10 |
| IUPAC Name | 5-ethyl-7,8-dimethoxypyrrolo[3,4-c]isoquinoline-1,3-dione |
| SMILES | CCc1nc2c(c3cc(OC)c(OC)cc13)C(=O)NC2=O |
| InChI | InChI=1S/C15H14N2O4/c1-4-9-7-5-10(20-2)11(21-3)6-8(7)12-13(16-9)15(19)17-14(12)18/h5-6H,4H2,1-3H3,(H,17,18,19) |
| InChIKey | ULVWJFBHQIXEPE-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 77.52 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.29 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|