C17H15N3S — CID 2382930
5,6-bis(4-methylphenyl)-2H-1,2,4-triazine-3-thione (PubChem CID 2382930) has the molecular formula C17H15N3S and a molecular weight of 293.40 g/mol. Its IUPAC name is 5,6-bis(4-methylphenyl)-2H-1,2,4-triazine-3-thione.
| Compound Name | 5,6-bis(4-methylphenyl)-2H-1,2,4-triazine-3-thione |
|---|---|
| PubChem CID | 2382930 |
| Molecular Formula | C17H15N3S |
| Molecular Weight | 293.40 g/mol |
| Exact Mass | 293.10 |
| IUPAC Name | 5,6-bis(4-methylphenyl)-2H-1,2,4-triazine-3-thione |
| SMILES | Cc1ccc(-c2n[nH]c(=S)nc2-c2ccc(C)cc2)cc1 |
| InChI | InChI=1S/C17H15N3S/c1-11-3-7-13(8-4-11)15-16(19-20-17(21)18-15)14-9-5-12(2)6-10-14/h3-10H,1-2H3,(H,18,20,21) |
| InChIKey | ZYXMIZXTCAQENT-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.40 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|