C17H22N4O3S3 — CID 23830387
methyl 2-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate (PubChem CID 23830387) has the molecular formula C17H22N4O3S3 and a molecular weight of 426.59 g/mol. Its IUPAC name is methyl 2-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate.
| Compound Name | methyl 2-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 23830387 |
| Molecular Formula | C17H22N4O3S3 |
| Molecular Weight | 426.59 g/mol |
| Exact Mass | 426.09 |
| IUPAC Name | methyl 2-[2-[(5-amino-1,3,4-thiadiazol-2-yl)sulfanyl]propanoylamino]-4,5,6,7,8,9-hexahydrocycloocta[b]thiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(C)Sc2nnc(N)s2)sc2c1CCCCCC2 |
| InChI | InChI=1S/C17H22N4O3S3/c1-9(25-17-21-20-16(18)27-17)13(22)19-14-12(15(23)24-2)10-7-5-3-4-6-8-11(10)26-14/h9H,3-8H2,1-2H3,(H2,18,20)(H,19,22) |
| InChIKey | ITMJTANCDMHCCS-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 107.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.59 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |