C29H28ClN3O5 — CID 2383114
methyl 2-[(5R,5aS)-1-benzyl-5-(4-chlorophenyl)-8,8-dimethyl-2,4,6-trioxo-5,5a,7,10-tetrahydropyrimido[4,5-b]quinolin-3-yl]acetate (PubChem CID 2383114) has the molecular formula C29H28ClN3O5 and a molecular weight of 534.01 g/mol. Its IUPAC name is methyl 2-[(5R,5aS)-1-benzyl-5-(4-chlorophenyl)-8,8-dimethyl-2,4,6-trioxo-5,5a,7,10-tetrahydropyrimido[4,5-b]quinolin-3-yl]acetate.
| Compound Name | methyl 2-[(5R,5aS)-1-benzyl-5-(4-chlorophenyl)-8,8-dimethyl-2,4,6-trioxo-5,5a,7,10-tetrahydropyrimido[4,5-b]quinolin-3-yl]acetate |
|---|---|
| PubChem CID | 2383114 |
| Molecular Formula | C29H28ClN3O5 |
| Molecular Weight | 534.01 g/mol |
| Exact Mass | 533.17 |
| IUPAC Name | methyl 2-[(5R,5aS)-1-benzyl-5-(4-chlorophenyl)-8,8-dimethyl-2,4,6-trioxo-5,5a,7,10-tetrahydropyrimido[4,5-b]quinolin-3-yl]acetate |
| SMILES | COC(=O)Cn1c(=O)c2c(n(Cc3ccccc3)c1=O)NC1=CC(C)(C)CC(=O)[C@H]1[C@@H]2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C29H28ClN3O5/c1-29(2)13-20-24(21(34)14-29)23(18-9-11-19(30)12-10-18)25-26(31-20)32(15-17-7-5-4-6-8-17)28(37)33(27(25)36)16-22(35)38-3/h4-13,23-24,31H,14-16H2,1-3H3/t23-,24-/m0/s1 |
| InChIKey | PQEQUNIGFAZFTD-ZEQRLZLVSA-N |
| XLogP | 3.94 |
| TPSA | 99.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 534.01 |
| LogP ≤ 5 | 3.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |