C19H25N3OS — CID 23831200
(3-amino-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl)-[(2R,6R)-2,6-dimethylpiperidin-1-yl]methanone (PubChem CID 23831200) has the molecular formula C19H25N3OS and a molecular weight of 343.50 g/mol. Its IUPAC name is (3-amino-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl)-[(2R,6R)-2,6-dimethylpiperidin-1-yl]methanone.
| Compound Name | (3-amino-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl)-[(2R,6R)-2,6-dimethylpiperidin-1-yl]methanone |
|---|---|
| PubChem CID | 23831200 |
| Molecular Formula | C19H25N3OS |
| Molecular Weight | 343.50 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | (3-amino-5,6,7,8-tetrahydrothieno[2,3-b]quinolin-2-yl)-[(2R,6R)-2,6-dimethylpiperidin-1-yl]methanone |
| SMILES | C[C@@H]1CCC[C@@H](C)N1C(=O)c1sc2nc3c(cc2c1N)CCCC3 |
| InChI | InChI=1S/C19H25N3OS/c1-11-6-5-7-12(2)22(11)19(23)17-16(20)14-10-13-8-3-4-9-15(13)21-18(14)24-17/h10-12H,3-9,20H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | PERGKTHAIORDHT-VXGBXAGGSA-N |
| XLogP | 4.16 |
| TPSA | 59.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.50 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |