C17H9F4N3O3 — CID 23831432
[2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl] quinoxaline-2-carboxylate (PubChem CID 23831432) has the molecular formula C17H9F4N3O3 and a molecular weight of 379.27 g/mol. Its IUPAC name is [2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl] quinoxaline-2-carboxylate.
| Compound Name | [2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl] quinoxaline-2-carboxylate |
|---|---|
| PubChem CID | 23831432 |
| Molecular Formula | C17H9F4N3O3 |
| Molecular Weight | 379.27 g/mol |
| Exact Mass | 379.06 |
| IUPAC Name | [2-oxo-2-(2,3,5,6-tetrafluoroanilino)ethyl] quinoxaline-2-carboxylate |
| SMILES | O=C(COC(=O)c1cnc2ccccc2n1)Nc1c(F)c(F)cc(F)c1F |
| InChI | InChI=1S/C17H9F4N3O3/c18-8-5-9(19)15(21)16(14(8)20)24-13(25)7-27-17(26)12-6-22-10-3-1-2-4-11(10)23-12/h1-6H,7H2,(H,24,25) |
| InChIKey | JUEDQMPTCOBXMU-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 81.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 379.27 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|