About [2-oxo-2-(5,7,7-trimethyl-2-azabicyclo[3.2.1]octan-2-yl)ethyl] quinoxaline-5-carboxylate
[2-oxo-2-(5,7,7-trimethyl-2-azabicyclo[3.2.1]octan-2-yl)ethyl] quinoxaline-5-carboxylate (PubChem CID 23831656) has the molecular formula C21H25N3O3
and a molecular weight of 367.45 g/mol. Its IUPAC name is [2-oxo-2-(5,7,7-trimethyl-2-azabicyclo[3.2.1]octan-2-yl)ethyl] quinoxaline-5-carboxylate.
Molecular Properties
| Compound Name | [2-oxo-2-(5,7,7-trimethyl-2-azabicyclo[3.2.1]octan-2-yl)ethyl] quinoxaline-5-carboxylate |
| PubChem CID | 23831656 |
| Molecular Formula | C21H25N3O3 |
| Molecular Weight | 367.45 g/mol |
| Exact Mass | 367.19 |
| IUPAC Name | [2-oxo-2-(5,7,7-trimethyl-2-azabicyclo[3.2.1]octan-2-yl)ethyl] quinoxaline-5-carboxylate |
| SMILES | CC12CCN(C(=O)COC(=O)c3cccc4nccnc34)C(C1)C(C)(C)C2 |
| InChI | InChI=1S/C21H25N3O3/c1-20(2)13-21(3)7-10-24(16(20)11-21)17(25)12-27-19(26)14-5-4-6-15-18(14)23-9-8-22-15/h4-6,8-9,16H,7,10-13H2,1-3H3 |
| InChIKey | CCCVRBMWNZHVMJ-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 72.39 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 367.45 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze [2-oxo-2-(5,7,7-trimethyl-2-azabicyclo[3.2.1]octan-2-yl)ethyl] quinoxaline-5-carboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-2-(5,7,7-trimethyl-2-azabicyclo[3.2.1]octan-2-yl)ethyl] quinoxaline-5-carboxylate?
The IUPAC name of [2-oxo-2-(5,7,7-trimethyl-2-azabicyclo[3.2.1]octan-2-yl)ethyl] quinoxaline-5-carboxylate (CID 23831656) is [2-oxo-2-(5,7,7-trimethyl-2-azabicyclo[3.2.1]octan-2-yl)ethyl] quinoxaline-5-carboxylate.
What is the SMILES notation for [2-oxo-2-(5,7,7-trimethyl-2-azabicyclo[3.2.1]octan-2-yl)ethyl] quinoxaline-5-carboxylate?
The canonical SMILES for [2-oxo-2-(5,7,7-trimethyl-2-azabicyclo[3.2.1]octan-2-yl)ethyl] quinoxaline-5-carboxylate is CC12CCN(C(=O)COC(=O)c3cccc4nccnc34)C(C1)C(C)(C)C2.
What is the InChIKey of [2-oxo-2-(5,7,7-trimethyl-2-azabicyclo[3.2.1]octan-2-yl)ethyl] quinoxaline-5-carboxylate?
The InChIKey is CCCVRBMWNZHVMJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H25N3O3/c1-20(2)13-21(3)7-10-24(16(20)11-21)17(25)12-27-19(26)14-5-4-6-15-18(14)23-9-8-22-15/h4-6,8-9,16H,7,10-13H2,1-3H3.
What are the key properties of [2-oxo-2-(5,7,7-trimethyl-2-azabicyclo[3.2.1]octan-2-yl)ethyl] quinoxaline-5-carboxylate?
[2-oxo-2-(5,7,7-trimethyl-2-azabicyclo[3.2.1]octan-2-yl)ethyl] quinoxaline-5-carboxylate has a molecular weight of 367.45 g/mol, XLogP of 3.21, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-2-(5,7,7-trimethyl-2-azabicyclo[3.2.1]octan-2-yl)ethyl] quinoxaline-5-carboxylate is sourced from PubChem (CID 23831656), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).