C26H33NO5S2 — CID 23831894
methyl 6-tert-butyl-2-[2-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyloxy)propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate (PubChem CID 23831894) has the molecular formula C26H33NO5S2 and a molecular weight of 503.69 g/mol. Its IUPAC name is methyl 6-tert-butyl-2-[2-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyloxy)propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate.
| Compound Name | methyl 6-tert-butyl-2-[2-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyloxy)propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
|---|---|
| PubChem CID | 23831894 |
| Molecular Formula | C26H33NO5S2 |
| Molecular Weight | 503.69 g/mol |
| Exact Mass | 503.18 |
| IUPAC Name | methyl 6-tert-butyl-2-[2-(4,5,6,7-tetrahydro-1-benzothiophene-2-carbonyloxy)propanoylamino]-4,5,6,7-tetrahydro-1-benzothiophene-3-carboxylate |
| SMILES | COC(=O)c1c(NC(=O)C(C)OC(=O)c2cc3c(s2)CCCC3)sc2c1CCC(C(C)(C)C)C2 |
| InChI | InChI=1S/C26H33NO5S2/c1-14(32-24(29)20-12-15-8-6-7-9-18(15)33-20)22(28)27-23-21(25(30)31-5)17-11-10-16(26(2,3)4)13-19(17)34-23/h12,14,16H,6-11,13H2,1-5H3,(H,27,28) |
| InChIKey | HDPYNUQLJNURJP-UHFFFAOYSA-N |
| XLogP | 5.81 |
| TPSA | 81.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.69 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |