C26H29N3O3 — CID 23832825
4-(2-ethoxyphenyl)-2,7,7-trimethyl-5-oxo-N-pyridin-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxamide (PubChem CID 23832825) has the molecular formula C26H29N3O3 and a molecular weight of 431.54 g/mol. Its IUPAC name is 4-(2-ethoxyphenyl)-2,7,7-trimethyl-5-oxo-N-pyridin-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxamide.
| Compound Name | 4-(2-ethoxyphenyl)-2,7,7-trimethyl-5-oxo-N-pyridin-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxamide |
|---|---|
| PubChem CID | 23832825 |
| Molecular Formula | C26H29N3O3 |
| Molecular Weight | 431.54 g/mol |
| Exact Mass | 431.22 |
| IUPAC Name | 4-(2-ethoxyphenyl)-2,7,7-trimethyl-5-oxo-N-pyridin-3-yl-1,4,6,8-tetrahydroquinoline-3-carboxamide |
| SMILES | CCOc1ccccc1C1C(C(=O)Nc2cccnc2)=C(C)NC2=C1C(=O)CC(C)(C)C2 |
| InChI | InChI=1S/C26H29N3O3/c1-5-32-21-11-7-6-10-18(21)23-22(25(31)29-17-9-8-12-27-15-17)16(2)28-19-13-26(3,4)14-20(30)24(19)23/h6-12,15,23,28H,5,13-14H2,1-4H3,(H,29,31) |
| InChIKey | MGPVDCBQPHFRKI-UHFFFAOYSA-N |
| XLogP | 4.72 |
| TPSA | 80.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.54 |
| LogP ≤ 5 | 4.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |