C19H25NO6 — CID 23834824
(3aS,5S,5aR,7S,8aS,8bR)-5a-hydroxy-7-[5-(hydroxymethyl)furan-2-yl]-5-methyl-2-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione (PubChem CID 23834824) has the molecular formula C19H25NO6 and a molecular weight of 363.41 g/mol. Its IUPAC name is (3aS,5S,5aR,7S,8aS,8bR)-5a-hydroxy-7-[5-(hydroxymethyl)furan-2-yl]-5-methyl-2-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione.
| Compound Name | (3aS,5S,5aR,7S,8aS,8bR)-5a-hydroxy-7-[5-(hydroxymethyl)furan-2-yl]-5-methyl-2-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23834824 |
| Molecular Formula | C19H25NO6 |
| Molecular Weight | 363.41 g/mol |
| Exact Mass | 363.17 |
| IUPAC Name | (3aS,5S,5aR,7S,8aS,8bR)-5a-hydroxy-7-[5-(hydroxymethyl)furan-2-yl]-5-methyl-2-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione |
| SMILES | CCCN1C(=O)[C@H]2[C@H](C[C@H](C)[C@@]3(O)O[C@H](c4ccc(CO)o4)C[C@@H]23)C1=O |
| InChI | InChI=1S/C19H25NO6/c1-3-6-20-17(22)12-7-10(2)19(24)13(16(12)18(20)23)8-15(26-19)14-5-4-11(9-21)25-14/h4-5,10,12-13,15-16,21,24H,3,6-9H2,1-2H3/t10-,12-,13-,15-,16-,19+/m0/s1 |
| InChIKey | OXQIQEJQHQSDIK-BLGKFFEOSA-N |
| XLogP | 1.59 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.41 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|