C21H29NO6 — CID 23834828
(3aS,5R,5aR,7S,8aS,8bR)-5a-hydroxy-7-[5-(hydroxymethyl)furan-2-yl]-5-propan-2-yl-2-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione (PubChem CID 23834828) has the molecular formula C21H29NO6 and a molecular weight of 391.46 g/mol. Its IUPAC name is (3aS,5R,5aR,7S,8aS,8bR)-5a-hydroxy-7-[5-(hydroxymethyl)furan-2-yl]-5-propan-2-yl-2-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione.
| Compound Name | (3aS,5R,5aR,7S,8aS,8bR)-5a-hydroxy-7-[5-(hydroxymethyl)furan-2-yl]-5-propan-2-yl-2-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione |
|---|---|
| PubChem CID | 23834828 |
| Molecular Formula | C21H29NO6 |
| Molecular Weight | 391.46 g/mol |
| Exact Mass | 391.20 |
| IUPAC Name | (3aS,5R,5aR,7S,8aS,8bR)-5a-hydroxy-7-[5-(hydroxymethyl)furan-2-yl]-5-propan-2-yl-2-propyl-4,5,7,8,8a,8b-hexahydro-3aH-furo[3,2-e]isoindole-1,3-dione |
| SMILES | CCCN1C(=O)[C@H]2[C@H](C[C@H](C(C)C)[C@@]3(O)O[C@H](c4ccc(CO)o4)C[C@@H]23)C1=O |
| InChI | InChI=1S/C21H29NO6/c1-4-7-22-19(24)13-8-14(11(2)3)21(26)15(18(13)20(22)25)9-17(28-21)16-6-5-12(10-23)27-16/h5-6,11,13-15,17-18,23,26H,4,7-10H2,1-3H3/t13-,14+,15-,17-,18-,21+/m0/s1 |
| InChIKey | OZLHSUFULAYREW-CWKNFWASSA-N |
| XLogP | 2.23 |
| TPSA | 100.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.46 |
| LogP ≤ 5 | 2.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|