C27H41N5O6 — CID 23834871
(3S,6S,7R,8aR)-3-(4-acetamidobutyl)-N-(5-aminopentyl)-6-[3-(2-hydroxyethoxy)phenyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide (PubChem CID 23834871) has the molecular formula C27H41N5O6 and a molecular weight of 531.65 g/mol. Its IUPAC name is (3S,6S,7R,8aR)-3-(4-acetamidobutyl)-N-(5-aminopentyl)-6-[3-(2-hydroxyethoxy)phenyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide.
| Compound Name | (3S,6S,7R,8aR)-3-(4-acetamidobutyl)-N-(5-aminopentyl)-6-[3-(2-hydroxyethoxy)phenyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
|---|---|
| PubChem CID | 23834871 |
| Molecular Formula | C27H41N5O6 |
| Molecular Weight | 531.65 g/mol |
| Exact Mass | 531.31 |
| IUPAC Name | (3S,6S,7R,8aR)-3-(4-acetamidobutyl)-N-(5-aminopentyl)-6-[3-(2-hydroxyethoxy)phenyl]-1,4-dioxo-2,3,6,7,8,8a-hexahydropyrrolo[1,2-a]pyrazine-7-carboxamide |
| SMILES | CC(=O)NCCCC[C@@H]1NC(=O)[C@H]2C[C@@H](C(=O)NCCCCCN)[C@@H](c3cccc(OCCO)c3)N2C1=O |
| InChI | InChI=1S/C27H41N5O6/c1-18(34)29-12-6-3-10-22-27(37)32-23(26(36)31-22)17-21(25(35)30-13-5-2-4-11-28)24(32)19-8-7-9-20(16-19)38-15-14-33/h7-9,16,21-24,33H,2-6,10-15,17,28H2,1H3,(H,29,34)(H,30,35)(H,31,36)/t21-,22+,23-,24-/m1/s1 |
| InChIKey | MBGHIIZYZBLTNN-UEQSERJNSA-N |
| XLogP | 0.37 |
| TPSA | 163.09 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.65 |
| LogP ≤ 5 | 0.37 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|